C21H25N3O6S — CID 2579679
[(2R)-1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 3-[ethyl(phenyl)sulfamoyl]benzoate (PubChem CID 2579679) has the molecular formula C21H25N3O6S and a molecular weight of 447.51 g/mol. Its IUPAC name is [(2R)-1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 3-[ethyl(phenyl)sulfamoyl]benzoate.
| Compound Name | [(2R)-1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 3-[ethyl(phenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 2579679 |
| Molecular Formula | C21H25N3O6S |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | [(2R)-1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 3-[ethyl(phenyl)sulfamoyl]benzoate |
| SMILES | CCNC(=O)NC(=O)[C@@H](C)OC(=O)c1cccc(S(=O)(=O)N(CC)c2ccccc2)c1 |
| InChI | InChI=1S/C21H25N3O6S/c1-4-22-21(27)23-19(25)15(3)30-20(26)16-10-9-13-18(14-16)31(28,29)24(5-2)17-11-7-6-8-12-17/h6-15H,4-5H2,1-3H3,(H2,22,23,25,27)/t15-/m1/s1 |
| InChIKey | XWARTZGLRZXIAU-OAHLLOKOSA-N |
| XLogP | 2.29 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |