C15H21N3O4 — CID 3919697
[1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 3-(dimethylamino)benzoate (PubChem CID 3919697) has the molecular formula C15H21N3O4 and a molecular weight of 307.35 g/mol. Its IUPAC name is [1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 3-(dimethylamino)benzoate.
| Compound Name | [1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 3-(dimethylamino)benzoate |
|---|---|
| PubChem CID | 3919697 |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | [1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 3-(dimethylamino)benzoate |
| SMILES | CCNC(=O)NC(=O)C(C)OC(=O)c1cccc(N(C)C)c1 |
| InChI | InChI=1S/C15H21N3O4/c1-5-16-15(21)17-13(19)10(2)22-14(20)11-7-6-8-12(9-11)18(3)4/h6-10H,5H2,1-4H3,(H2,16,17,19,21) |
| InChIKey | RMWUGFIULDOJFH-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |