C18H19ClN2O3 — CID 2518750
[(2R)-1-(4-chloroanilino)-1-oxopropan-2-yl] 3-(dimethylamino)benzoate (PubChem CID 2518750) has the molecular formula C18H19ClN2O3 and a molecular weight of 346.81 g/mol. Its IUPAC name is [(2R)-1-(4-chloroanilino)-1-oxopropan-2-yl] 3-(dimethylamino)benzoate.
| Compound Name | [(2R)-1-(4-chloroanilino)-1-oxopropan-2-yl] 3-(dimethylamino)benzoate |
|---|---|
| PubChem CID | 2518750 |
| Molecular Formula | C18H19ClN2O3 |
| Molecular Weight | 346.81 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | [(2R)-1-(4-chloroanilino)-1-oxopropan-2-yl] 3-(dimethylamino)benzoate |
| SMILES | C[C@@H](OC(=O)c1cccc(N(C)C)c1)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H19ClN2O3/c1-12(17(22)20-15-9-7-14(19)8-10-15)24-18(23)13-5-4-6-16(11-13)21(2)3/h4-12H,1-3H3,(H,20,22)/t12-/m1/s1 |
| InChIKey | BZURPBVZGPNFEO-GFCCVEGCSA-N |
| XLogP | 3.59 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.81 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |