C18H19FN2O3 — CID 2523892
[(2S)-1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 3-fluorobenzoate (PubChem CID 2523892) has the molecular formula C18H19FN2O3 and a molecular weight of 330.36 g/mol. Its IUPAC name is [(2S)-1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 3-fluorobenzoate.
| Compound Name | [(2S)-1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 3-fluorobenzoate |
|---|---|
| PubChem CID | 2523892 |
| Molecular Formula | C18H19FN2O3 |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | [(2S)-1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 3-fluorobenzoate |
| SMILES | C[C@H](OC(=O)c1cccc(F)c1)C(=O)Nc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C18H19FN2O3/c1-12(24-18(23)13-5-4-6-14(19)11-13)17(22)20-15-7-9-16(10-8-15)21(2)3/h4-12H,1-3H3,(H,20,22)/t12-/m0/s1 |
| InChIKey | BLAUFUCRWALOHJ-LBPRGKRZSA-N |
| XLogP | 3.08 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|