C20H18F6N2O3 — CID 55314234
[1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 3,5-bis(trifluoromethyl)benzoate (PubChem CID 55314234) has the molecular formula C20H18F6N2O3 and a molecular weight of 448.36 g/mol. Its IUPAC name is [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 3,5-bis(trifluoromethyl)benzoate.
| Compound Name | [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 3,5-bis(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 55314234 |
| Molecular Formula | C20H18F6N2O3 |
| Molecular Weight | 448.36 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 3,5-bis(trifluoromethyl)benzoate |
| SMILES | CC(OC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(=O)Nc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C20H18F6N2O3/c1-11(17(29)27-15-4-6-16(7-5-15)28(2)3)31-18(30)12-8-13(19(21,22)23)10-14(9-12)20(24,25)26/h4-11H,1-3H3,(H,27,29) |
| InChIKey | HQUJEORCIBRJJP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.36 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|