C16H18N2O4 — CID 42923579
[1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] furan-3-carboxylate (PubChem CID 42923579) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] furan-3-carboxylate.
| Compound Name | [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] furan-3-carboxylate |
|---|---|
| PubChem CID | 42923579 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] furan-3-carboxylate |
| SMILES | CC(OC(=O)c1ccoc1)C(=O)Nc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C16H18N2O4/c1-11(22-16(20)12-8-9-21-10-12)15(19)17-13-4-6-14(7-5-13)18(2)3/h4-11H,1-3H3,(H,17,19) |
| InChIKey | ROFDAWVSEBQRME-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|