C15H11ClN2O4 — CID 26985754
[(2S)-1-(3-chloro-4-cyanoanilino)-1-oxopropan-2-yl] furan-3-carboxylate (PubChem CID 26985754) has the molecular formula C15H11ClN2O4 and a molecular weight of 318.72 g/mol. Its IUPAC name is [(2S)-1-(3-chloro-4-cyanoanilino)-1-oxopropan-2-yl] furan-3-carboxylate.
| Compound Name | [(2S)-1-(3-chloro-4-cyanoanilino)-1-oxopropan-2-yl] furan-3-carboxylate |
|---|---|
| PubChem CID | 26985754 |
| Molecular Formula | C15H11ClN2O4 |
| Molecular Weight | 318.72 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | [(2S)-1-(3-chloro-4-cyanoanilino)-1-oxopropan-2-yl] furan-3-carboxylate |
| SMILES | C[C@H](OC(=O)c1ccoc1)C(=O)Nc1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C15H11ClN2O4/c1-9(22-15(20)11-4-5-21-8-11)14(19)18-12-3-2-10(7-17)13(16)6-12/h2-6,8-9H,1H3,(H,18,19)/t9-/m0/s1 |
| InChIKey | ATRHCFLTAOGXDM-VIFPVBQESA-N |
| XLogP | 2.99 |
| TPSA | 92.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.72 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |