C15H10ClN3O6 — CID 55417911
[1-(3-chloro-4-cyanoanilino)-1-oxopropan-2-yl] 5-nitrofuran-2-carboxylate (PubChem CID 55417911) has the molecular formula C15H10ClN3O6 and a molecular weight of 363.71 g/mol. Its IUPAC name is [1-(3-chloro-4-cyanoanilino)-1-oxopropan-2-yl] 5-nitrofuran-2-carboxylate.
| Compound Name | [1-(3-chloro-4-cyanoanilino)-1-oxopropan-2-yl] 5-nitrofuran-2-carboxylate |
|---|---|
| PubChem CID | 55417911 |
| Molecular Formula | C15H10ClN3O6 |
| Molecular Weight | 363.71 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | [1-(3-chloro-4-cyanoanilino)-1-oxopropan-2-yl] 5-nitrofuran-2-carboxylate |
| SMILES | CC(OC(=O)c1ccc([N+](=O)[O-])o1)C(=O)Nc1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C15H10ClN3O6/c1-8(24-15(21)12-4-5-13(25-12)19(22)23)14(20)18-10-3-2-9(7-17)11(16)6-10/h2-6,8H,1H3,(H,18,20) |
| InChIKey | NHFCMUPUSODPOY-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 135.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.71 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|