C15H10ClF3N2O6 — CID 7967501
[(2R)-1-[2-chloro-5-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 5-nitrofuran-2-carboxylate (PubChem CID 7967501) has the molecular formula C15H10ClF3N2O6 and a molecular weight of 406.70 g/mol. Its IUPAC name is [(2R)-1-[2-chloro-5-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 5-nitrofuran-2-carboxylate.
| Compound Name | [(2R)-1-[2-chloro-5-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 5-nitrofuran-2-carboxylate |
|---|---|
| PubChem CID | 7967501 |
| Molecular Formula | C15H10ClF3N2O6 |
| Molecular Weight | 406.70 g/mol |
| Exact Mass | 406.02 |
| IUPAC Name | [(2R)-1-[2-chloro-5-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 5-nitrofuran-2-carboxylate |
| SMILES | C[C@@H](OC(=O)c1ccc([N+](=O)[O-])o1)C(=O)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C15H10ClF3N2O6/c1-7(26-14(23)11-4-5-12(27-11)21(24)25)13(22)20-10-6-8(15(17,18)19)2-3-9(10)16/h2-7H,1H3,(H,20,22)/t7-/m1/s1 |
| InChIKey | GWOYJPHZWSWRIF-SSDOTTSWSA-N |
| XLogP | 4.04 |
| TPSA | 111.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.70 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|