C14H13ClF3NO3 — CID 2358382
[(2S)-1-[2-chloro-5-(trifluoromethyl)anilino]-1-oxopropan-2-yl] cyclopropanecarboxylate (PubChem CID 2358382) has the molecular formula C14H13ClF3NO3 and a molecular weight of 335.71 g/mol. Its IUPAC name is [(2S)-1-[2-chloro-5-(trifluoromethyl)anilino]-1-oxopropan-2-yl] cyclopropanecarboxylate.
| Compound Name | [(2S)-1-[2-chloro-5-(trifluoromethyl)anilino]-1-oxopropan-2-yl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 2358382 |
| Molecular Formula | C14H13ClF3NO3 |
| Molecular Weight | 335.71 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | [(2S)-1-[2-chloro-5-(trifluoromethyl)anilino]-1-oxopropan-2-yl] cyclopropanecarboxylate |
| SMILES | C[C@H](OC(=O)C1CC1)C(=O)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C14H13ClF3NO3/c1-7(22-13(21)8-2-3-8)12(20)19-11-6-9(14(16,17)18)4-5-10(11)15/h4-8H,2-3H2,1H3,(H,19,20)/t7-/m0/s1 |
| InChIKey | PVIZCPFRCFMYAP-ZETCQYMHSA-N |
| XLogP | 3.64 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.71 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |