C19H17ClF3NO3 — CID 7654429
[(2R)-1-[2-chloro-5-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 3-phenylpropanoate (PubChem CID 7654429) has the molecular formula C19H17ClF3NO3 and a molecular weight of 399.80 g/mol. Its IUPAC name is [(2R)-1-[2-chloro-5-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 3-phenylpropanoate.
| Compound Name | [(2R)-1-[2-chloro-5-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 3-phenylpropanoate |
|---|---|
| PubChem CID | 7654429 |
| Molecular Formula | C19H17ClF3NO3 |
| Molecular Weight | 399.80 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | [(2R)-1-[2-chloro-5-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 3-phenylpropanoate |
| SMILES | C[C@@H](OC(=O)CCc1ccccc1)C(=O)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C19H17ClF3NO3/c1-12(27-17(25)10-7-13-5-3-2-4-6-13)18(26)24-16-11-14(19(21,22)23)8-9-15(16)20/h2-6,8-9,11-12H,7,10H2,1H3,(H,24,26)/t12-/m1/s1 |
| InChIKey | RFZTVRCGNVMLJS-GFCCVEGCSA-N |
| XLogP | 4.86 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.80 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |