C15H16ClF3N2O4 — CID 42898379
[1-[2-chloro-5-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 3-acetamidopropanoate (PubChem CID 42898379) has the molecular formula C15H16ClF3N2O4 and a molecular weight of 380.75 g/mol. Its IUPAC name is [1-[2-chloro-5-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 3-acetamidopropanoate.
| Compound Name | [1-[2-chloro-5-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 3-acetamidopropanoate |
|---|---|
| PubChem CID | 42898379 |
| Molecular Formula | C15H16ClF3N2O4 |
| Molecular Weight | 380.75 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | [1-[2-chloro-5-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 3-acetamidopropanoate |
| SMILES | CC(=O)NCCC(=O)OC(C)C(=O)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C15H16ClF3N2O4/c1-8(25-13(23)5-6-20-9(2)22)14(24)21-12-7-10(15(17,18)19)3-4-11(12)16/h3-4,7-8H,5-6H2,1-2H3,(H,20,22)(H,21,24) |
| InChIKey | HQLPQOVNBDNYCM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.75 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |