C10H8Cl2F3NO — CID 2396545
(2R)-2-chloro-N-[2-chloro-5-(trifluoromethyl)phenyl]propanamide (PubChem CID 2396545) has the molecular formula C10H8Cl2F3NO and a molecular weight of 286.08 g/mol. Its IUPAC name is (2R)-2-chloro-N-[2-chloro-5-(trifluoromethyl)phenyl]propanamide.
| Compound Name | (2R)-2-chloro-N-[2-chloro-5-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 2396545 |
| Molecular Formula | C10H8Cl2F3NO |
| Molecular Weight | 286.08 g/mol |
| Exact Mass | 284.99 |
| IUPAC Name | (2R)-2-chloro-N-[2-chloro-5-(trifluoromethyl)phenyl]propanamide |
| SMILES | C[C@@H](Cl)C(=O)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C10H8Cl2F3NO/c1-5(11)9(17)16-8-4-6(10(13,14)15)2-3-7(8)12/h2-5H,1H3,(H,16,17)/t5-/m1/s1 |
| InChIKey | GVZJPYFBHFOGLJ-RXMQYKEDSA-N |
| XLogP | 3.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.08 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|