C15H10Cl2F3NO — CID 4117637
2-chloro-N-[2-chloro-5-(trifluoromethyl)phenyl]-2-phenylacetamide (PubChem CID 4117637) has the molecular formula C15H10Cl2F3NO and a molecular weight of 348.15 g/mol. Its IUPAC name is 2-chloro-N-[2-chloro-5-(trifluoromethyl)phenyl]-2-phenylacetamide.
| Compound Name | 2-chloro-N-[2-chloro-5-(trifluoromethyl)phenyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 4117637 |
| Molecular Formula | C15H10Cl2F3NO |
| Molecular Weight | 348.15 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | 2-chloro-N-[2-chloro-5-(trifluoromethyl)phenyl]-2-phenylacetamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)ccc1Cl)C(Cl)c1ccccc1 |
| InChI | InChI=1S/C15H10Cl2F3NO/c16-11-7-6-10(15(18,19)20)8-12(11)21-14(22)13(17)9-4-2-1-3-5-9/h1-8,13H,(H,21,22) |
| InChIKey | RZBPCVWWCYSNQO-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.15 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|