C23H17ClF3NO3S — CID 4005451
[2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] 2-phenylsulfanylacetate (PubChem CID 4005451) has the molecular formula C23H17ClF3NO3S and a molecular weight of 479.91 g/mol. Its IUPAC name is [2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] 2-phenylsulfanylacetate.
| Compound Name | [2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] 2-phenylsulfanylacetate |
|---|---|
| PubChem CID | 4005451 |
| Molecular Formula | C23H17ClF3NO3S |
| Molecular Weight | 479.91 g/mol |
| Exact Mass | 479.06 |
| IUPAC Name | [2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] 2-phenylsulfanylacetate |
| SMILES | O=C(CSc1ccccc1)OC(C(=O)Nc1cc(C(F)(F)F)ccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C23H17ClF3NO3S/c24-18-12-11-16(23(25,26)27)13-19(18)28-22(30)21(15-7-3-1-4-8-15)31-20(29)14-32-17-9-5-2-6-10-17/h1-13,21H,14H2,(H,28,30) |
| InChIKey | CBVIGWHGVBIGDF-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.91 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |