C25H19ClF3N3O6 — CID 2401184
[(1S)-2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] 2-[(3-methyl-4-nitrobenzoyl)amino]acetate (PubChem CID 2401184) has the molecular formula C25H19ClF3N3O6 and a molecular weight of 549.89 g/mol. Its IUPAC name is [(1S)-2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] 2-[(3-methyl-4-nitrobenzoyl)amino]acetate.
| Compound Name | [(1S)-2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] 2-[(3-methyl-4-nitrobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 2401184 |
| Molecular Formula | C25H19ClF3N3O6 |
| Molecular Weight | 549.89 g/mol |
| Exact Mass | 549.09 |
| IUPAC Name | [(1S)-2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] 2-[(3-methyl-4-nitrobenzoyl)amino]acetate |
| SMILES | Cc1cc(C(=O)NCC(=O)O[C@H](C(=O)Nc2cc(C(F)(F)F)ccc2Cl)c2ccccc2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H19ClF3N3O6/c1-14-11-16(7-10-20(14)32(36)37)23(34)30-13-21(33)38-22(15-5-3-2-4-6-15)24(35)31-19-12-17(25(27,28)29)8-9-18(19)26/h2-12,22H,13H2,1H3,(H,30,34)(H,31,35)/t22-/m0/s1 |
| InChIKey | FHYGFHQBXJYJHC-QFIPXVFZSA-N |
| XLogP | 5.23 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.89 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|