C26H23ClF3NO3 — CID 2392218
[(1S)-2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] 4-tert-butylbenzoate (PubChem CID 2392218) has the molecular formula C26H23ClF3NO3 and a molecular weight of 489.92 g/mol. Its IUPAC name is [(1S)-2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] 4-tert-butylbenzoate.
| Compound Name | [(1S)-2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] 4-tert-butylbenzoate |
|---|---|
| PubChem CID | 2392218 |
| Molecular Formula | C26H23ClF3NO3 |
| Molecular Weight | 489.92 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | [(1S)-2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] 4-tert-butylbenzoate |
| SMILES | CC(C)(C)c1ccc(C(=O)O[C@H](C(=O)Nc2cc(C(F)(F)F)ccc2Cl)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H23ClF3NO3/c1-25(2,3)18-11-9-17(10-12-18)24(33)34-22(16-7-5-4-6-8-16)23(32)31-21-15-19(26(28,29)30)13-14-20(21)27/h4-15,22H,1-3H3,(H,31,32)/t22-/m0/s1 |
| InChIKey | WYYKDGMCDHLQPT-QFIPXVFZSA-N |
| XLogP | 7.19 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.92 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |