C21H14ClF3N2O3 — CID 3575715
[2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] pyridine-3-carboxylate (PubChem CID 3575715) has the molecular formula C21H14ClF3N2O3 and a molecular weight of 434.80 g/mol. Its IUPAC name is [2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] pyridine-3-carboxylate.
| Compound Name | [2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 3575715 |
| Molecular Formula | C21H14ClF3N2O3 |
| Molecular Weight | 434.80 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | [2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] pyridine-3-carboxylate |
| SMILES | O=C(OC(C(=O)Nc1cc(C(F)(F)F)ccc1Cl)c1ccccc1)c1cccnc1 |
| InChI | InChI=1S/C21H14ClF3N2O3/c22-16-9-8-15(21(23,24)25)11-17(16)27-19(28)18(13-5-2-1-3-6-13)30-20(29)14-7-4-10-26-12-14/h1-12,18H,(H,27,28) |
| InChIKey | UGJRUCMHRYFKLM-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.80 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |