C21H17ClF3NO3 — CID 16525212
[2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] (2E,4E)-hexa-2,4-dienoate (PubChem CID 16525212) has the molecular formula C21H17ClF3NO3 and a molecular weight of 423.82 g/mol. Its IUPAC name is [2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] (2E,4E)-hexa-2,4-dienoate.
| Compound Name | [2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] (2E,4E)-hexa-2,4-dienoate |
|---|---|
| PubChem CID | 16525212 |
| Molecular Formula | C21H17ClF3NO3 |
| Molecular Weight | 423.82 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | [2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] (2E,4E)-hexa-2,4-dienoate |
| SMILES | C/C=C/C=C/C(=O)OC(C(=O)Nc1cc(C(F)(F)F)ccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C21H17ClF3NO3/c1-2-3-5-10-18(27)29-19(14-8-6-4-7-9-14)20(28)26-17-13-15(21(23,24)25)11-12-16(17)22/h2-13,19H,1H3,(H,26,28)/b3-2+,10-5+ |
| InChIKey | MAVXKNJBELMIES-XPQLPGEHSA-N |
| XLogP | 5.71 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.82 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|