C23H14ClF3N2O3 — CID 2355350
[(1R)-2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] 4-cyanobenzoate (PubChem CID 2355350) has the molecular formula C23H14ClF3N2O3 and a molecular weight of 458.82 g/mol. Its IUPAC name is [(1R)-2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] 4-cyanobenzoate.
| Compound Name | [(1R)-2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] 4-cyanobenzoate |
|---|---|
| PubChem CID | 2355350 |
| Molecular Formula | C23H14ClF3N2O3 |
| Molecular Weight | 458.82 g/mol |
| Exact Mass | 458.06 |
| IUPAC Name | [(1R)-2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] 4-cyanobenzoate |
| SMILES | N#Cc1ccc(C(=O)O[C@@H](C(=O)Nc2cc(C(F)(F)F)ccc2Cl)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H14ClF3N2O3/c24-18-11-10-17(23(25,26)27)12-19(18)29-21(30)20(15-4-2-1-3-5-15)32-22(31)16-8-6-14(13-28)7-9-16/h1-12,20H,(H,29,30)/t20-/m1/s1 |
| InChIKey | AXIDDHALPWSATC-HXUWFJFHSA-N |
| XLogP | 5.77 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.82 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |