C22H15ClF3NO3 — CID 2360642
[(1R)-2-oxo-1-phenyl-2-[3-(trifluoromethyl)anilino]ethyl] 4-chlorobenzoate (PubChem CID 2360642) has the molecular formula C22H15ClF3NO3 and a molecular weight of 433.81 g/mol. Its IUPAC name is [(1R)-2-oxo-1-phenyl-2-[3-(trifluoromethyl)anilino]ethyl] 4-chlorobenzoate.
| Compound Name | [(1R)-2-oxo-1-phenyl-2-[3-(trifluoromethyl)anilino]ethyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 2360642 |
| Molecular Formula | C22H15ClF3NO3 |
| Molecular Weight | 433.81 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | [(1R)-2-oxo-1-phenyl-2-[3-(trifluoromethyl)anilino]ethyl] 4-chlorobenzoate |
| SMILES | O=C(O[C@@H](C(=O)Nc1cccc(C(F)(F)F)c1)c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H15ClF3NO3/c23-17-11-9-15(10-12-17)21(29)30-19(14-5-2-1-3-6-14)20(28)27-18-8-4-7-16(13-18)22(24,25)26/h1-13,19H,(H,27,28)/t19-/m1/s1 |
| InChIKey | TXWIBAZSCUQREK-LJQANCHMSA-N |
| XLogP | 5.90 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.81 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |