C22H17F3N2O4 — CID 55556432
[2-oxo-1-phenyl-2-[3-(trifluoromethyl)anilino]ethyl] 2-methoxypyridine-3-carboxylate (PubChem CID 55556432) has the molecular formula C22H17F3N2O4 and a molecular weight of 430.38 g/mol. Its IUPAC name is [2-oxo-1-phenyl-2-[3-(trifluoromethyl)anilino]ethyl] 2-methoxypyridine-3-carboxylate.
| Compound Name | [2-oxo-1-phenyl-2-[3-(trifluoromethyl)anilino]ethyl] 2-methoxypyridine-3-carboxylate |
|---|---|
| PubChem CID | 55556432 |
| Molecular Formula | C22H17F3N2O4 |
| Molecular Weight | 430.38 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | [2-oxo-1-phenyl-2-[3-(trifluoromethyl)anilino]ethyl] 2-methoxypyridine-3-carboxylate |
| SMILES | COc1ncccc1C(=O)OC(C(=O)Nc1cccc(C(F)(F)F)c1)c1ccccc1 |
| InChI | InChI=1S/C22H17F3N2O4/c1-30-20-17(11-6-12-26-20)21(29)31-18(14-7-3-2-4-8-14)19(28)27-16-10-5-9-15(13-16)22(23,24)25/h2-13,18H,1H3,(H,27,28) |
| InChIKey | WUOMOOMACWKCDA-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.38 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |