C18H17F3N2O3 — CID 7953763
[(2R)-1-oxo-1-[3-(trifluoromethyl)anilino]propan-2-yl] 2-(methylamino)benzoate (PubChem CID 7953763) has the molecular formula C18H17F3N2O3 and a molecular weight of 366.34 g/mol. Its IUPAC name is [(2R)-1-oxo-1-[3-(trifluoromethyl)anilino]propan-2-yl] 2-(methylamino)benzoate.
| Compound Name | [(2R)-1-oxo-1-[3-(trifluoromethyl)anilino]propan-2-yl] 2-(methylamino)benzoate |
|---|---|
| PubChem CID | 7953763 |
| Molecular Formula | C18H17F3N2O3 |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | [(2R)-1-oxo-1-[3-(trifluoromethyl)anilino]propan-2-yl] 2-(methylamino)benzoate |
| SMILES | CNc1ccccc1C(=O)O[C@H](C)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H17F3N2O3/c1-11(26-17(25)14-8-3-4-9-15(14)22-2)16(24)23-13-7-5-6-12(10-13)18(19,20)21/h3-11,22H,1-2H3,(H,23,24)/t11-/m1/s1 |
| InChIKey | PCBRPZWOWZREPQ-LLVKDONJSA-N |
| XLogP | 3.93 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |