C19H20N2O4 — CID 7953511
[(2S)-1-(3-acetylanilino)-1-oxopropan-2-yl] 2-(methylamino)benzoate (PubChem CID 7953511) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is [(2S)-1-(3-acetylanilino)-1-oxopropan-2-yl] 2-(methylamino)benzoate.
| Compound Name | [(2S)-1-(3-acetylanilino)-1-oxopropan-2-yl] 2-(methylamino)benzoate |
|---|---|
| PubChem CID | 7953511 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | [(2S)-1-(3-acetylanilino)-1-oxopropan-2-yl] 2-(methylamino)benzoate |
| SMILES | CNc1ccccc1C(=O)O[C@@H](C)C(=O)Nc1cccc(C(C)=O)c1 |
| InChI | InChI=1S/C19H20N2O4/c1-12(22)14-7-6-8-15(11-14)21-18(23)13(2)25-19(24)16-9-4-5-10-17(16)20-3/h4-11,13,20H,1-3H3,(H,21,23)/t13-/m0/s1 |
| InChIKey | FUTKSAMNPIUKEO-ZDUSSCGKSA-N |
| XLogP | 3.11 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |