C26H21NO4 — CID 7786471
[(2R)-1-(3-acetylanilino)-1-oxopropan-2-yl] anthracene-9-carboxylate (PubChem CID 7786471) has the molecular formula C26H21NO4 and a molecular weight of 411.46 g/mol. Its IUPAC name is [(2R)-1-(3-acetylanilino)-1-oxopropan-2-yl] anthracene-9-carboxylate.
| Compound Name | [(2R)-1-(3-acetylanilino)-1-oxopropan-2-yl] anthracene-9-carboxylate |
|---|---|
| PubChem CID | 7786471 |
| Molecular Formula | C26H21NO4 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | [(2R)-1-(3-acetylanilino)-1-oxopropan-2-yl] anthracene-9-carboxylate |
| SMILES | CC(=O)c1cccc(NC(=O)[C@@H](C)OC(=O)c2c3ccccc3cc3ccccc23)c1 |
| InChI | InChI=1S/C26H21NO4/c1-16(28)18-10-7-11-21(15-18)27-25(29)17(2)31-26(30)24-22-12-5-3-8-19(22)14-20-9-4-6-13-23(20)24/h3-15,17H,1-2H3,(H,27,29)/t17-/m1/s1 |
| InChIKey | YIZVXQVAWIUWIN-QGZVFWFLSA-N |
| XLogP | 5.38 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|