C24H17F3N2O3S — CID 4842408
[1-oxo-1-[3-(trifluoromethyl)anilino]propan-2-yl] 2-(2-cyanophenyl)sulfanylbenzoate (PubChem CID 4842408) has the molecular formula C24H17F3N2O3S and a molecular weight of 470.47 g/mol. Its IUPAC name is [1-oxo-1-[3-(trifluoromethyl)anilino]propan-2-yl] 2-(2-cyanophenyl)sulfanylbenzoate.
| Compound Name | [1-oxo-1-[3-(trifluoromethyl)anilino]propan-2-yl] 2-(2-cyanophenyl)sulfanylbenzoate |
|---|---|
| PubChem CID | 4842408 |
| Molecular Formula | C24H17F3N2O3S |
| Molecular Weight | 470.47 g/mol |
| Exact Mass | 470.09 |
| IUPAC Name | [1-oxo-1-[3-(trifluoromethyl)anilino]propan-2-yl] 2-(2-cyanophenyl)sulfanylbenzoate |
| SMILES | CC(OC(=O)c1ccccc1Sc1ccccc1C#N)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H17F3N2O3S/c1-15(22(30)29-18-9-6-8-17(13-18)24(25,26)27)32-23(31)19-10-3-5-12-21(19)33-20-11-4-2-7-16(20)14-28/h2-13,15H,1H3,(H,29,30) |
| InChIKey | SAXNLMKSRRPORS-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.47 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |