C27H20N2O3S — CID 4845878
[1-(naphthalen-2-ylamino)-1-oxopropan-2-yl] 2-(2-cyanophenyl)sulfanylbenzoate (PubChem CID 4845878) has the molecular formula C27H20N2O3S and a molecular weight of 452.54 g/mol. Its IUPAC name is [1-(naphthalen-2-ylamino)-1-oxopropan-2-yl] 2-(2-cyanophenyl)sulfanylbenzoate.
| Compound Name | [1-(naphthalen-2-ylamino)-1-oxopropan-2-yl] 2-(2-cyanophenyl)sulfanylbenzoate |
|---|---|
| PubChem CID | 4845878 |
| Molecular Formula | C27H20N2O3S |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | [1-(naphthalen-2-ylamino)-1-oxopropan-2-yl] 2-(2-cyanophenyl)sulfanylbenzoate |
| SMILES | CC(OC(=O)c1ccccc1Sc1ccccc1C#N)C(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C27H20N2O3S/c1-18(26(30)29-22-15-14-19-8-2-3-9-20(19)16-22)32-27(31)23-11-5-7-13-25(23)33-24-12-6-4-10-21(24)17-28/h2-16,18H,1H3,(H,29,30) |
| InChIKey | ZPQYZBKDVBZEHV-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |