C18H15F3N2O5 — CID 8710068
[(2S)-1-oxo-1-[3-(trifluoromethyl)anilino]propan-2-yl] 2-methyl-3-nitrobenzoate (PubChem CID 8710068) has the molecular formula C18H15F3N2O5 and a molecular weight of 396.32 g/mol. Its IUPAC name is [(2S)-1-oxo-1-[3-(trifluoromethyl)anilino]propan-2-yl] 2-methyl-3-nitrobenzoate.
| Compound Name | [(2S)-1-oxo-1-[3-(trifluoromethyl)anilino]propan-2-yl] 2-methyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 8710068 |
| Molecular Formula | C18H15F3N2O5 |
| Molecular Weight | 396.32 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | [(2S)-1-oxo-1-[3-(trifluoromethyl)anilino]propan-2-yl] 2-methyl-3-nitrobenzoate |
| SMILES | Cc1c(C(=O)O[C@@H](C)C(=O)Nc2cccc(C(F)(F)F)c2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H15F3N2O5/c1-10-14(7-4-8-15(10)23(26)27)17(25)28-11(2)16(24)22-13-6-3-5-12(9-13)18(19,20)21/h3-9,11H,1-2H3,(H,22,24)/t11-/m0/s1 |
| InChIKey | RZFHLRYCEBMKGL-NSHDSACASA-N |
| XLogP | 4.11 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.32 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|