C19H21N3O7S — CID 42901144
[1-[3-(dimethylsulfamoyl)anilino]-1-oxopropan-2-yl] 2-methyl-3-nitrobenzoate (PubChem CID 42901144) has the molecular formula C19H21N3O7S and a molecular weight of 435.46 g/mol. Its IUPAC name is [1-[3-(dimethylsulfamoyl)anilino]-1-oxopropan-2-yl] 2-methyl-3-nitrobenzoate.
| Compound Name | [1-[3-(dimethylsulfamoyl)anilino]-1-oxopropan-2-yl] 2-methyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 42901144 |
| Molecular Formula | C19H21N3O7S |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | [1-[3-(dimethylsulfamoyl)anilino]-1-oxopropan-2-yl] 2-methyl-3-nitrobenzoate |
| SMILES | Cc1c(C(=O)OC(C)C(=O)Nc2cccc(S(=O)(=O)N(C)C)c2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H21N3O7S/c1-12-16(9-6-10-17(12)22(25)26)19(24)29-13(2)18(23)20-14-7-5-8-15(11-14)30(27,28)21(3)4/h5-11,13H,1-4H3,(H,20,23) |
| InChIKey | TVRSBOOWLVETIN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|