C18H19FN2O5S — CID 7864249
[(2S)-1-[3-(dimethylsulfamoyl)anilino]-1-oxopropan-2-yl] 2-fluorobenzoate (PubChem CID 7864249) has the molecular formula C18H19FN2O5S and a molecular weight of 394.42 g/mol. Its IUPAC name is [(2S)-1-[3-(dimethylsulfamoyl)anilino]-1-oxopropan-2-yl] 2-fluorobenzoate.
| Compound Name | [(2S)-1-[3-(dimethylsulfamoyl)anilino]-1-oxopropan-2-yl] 2-fluorobenzoate |
|---|---|
| PubChem CID | 7864249 |
| Molecular Formula | C18H19FN2O5S |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | [(2S)-1-[3-(dimethylsulfamoyl)anilino]-1-oxopropan-2-yl] 2-fluorobenzoate |
| SMILES | C[C@H](OC(=O)c1ccccc1F)C(=O)Nc1cccc(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C18H19FN2O5S/c1-12(26-18(23)15-9-4-5-10-16(15)19)17(22)20-13-7-6-8-14(11-13)27(24,25)21(2)3/h4-12H,1-3H3,(H,20,22)/t12-/m0/s1 |
| InChIKey | NPFIPVRIRBPXQB-LBPRGKRZSA-N |
| XLogP | 2.26 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |