C19H19N3O5S — CID 8018615
[(2R)-1-[3-(dimethylsulfamoyl)anilino]-1-oxopropan-2-yl] 4-cyanobenzoate (PubChem CID 8018615) has the molecular formula C19H19N3O5S and a molecular weight of 401.44 g/mol. Its IUPAC name is [(2R)-1-[3-(dimethylsulfamoyl)anilino]-1-oxopropan-2-yl] 4-cyanobenzoate.
| Compound Name | [(2R)-1-[3-(dimethylsulfamoyl)anilino]-1-oxopropan-2-yl] 4-cyanobenzoate |
|---|---|
| PubChem CID | 8018615 |
| Molecular Formula | C19H19N3O5S |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | [(2R)-1-[3-(dimethylsulfamoyl)anilino]-1-oxopropan-2-yl] 4-cyanobenzoate |
| SMILES | C[C@@H](OC(=O)c1ccc(C#N)cc1)C(=O)Nc1cccc(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C19H19N3O5S/c1-13(27-19(24)15-9-7-14(12-20)8-10-15)18(23)21-16-5-4-6-17(11-16)28(25,26)22(2)3/h4-11,13H,1-3H3,(H,21,23)/t13-/m1/s1 |
| InChIKey | JCTOJBYQZNUHDS-CYBMUJFWSA-N |
| XLogP | 1.99 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |