C18H14F2N2O5S — CID 7679828
[(2R)-1-(3-cyanoanilino)-1-oxopropan-2-yl] 4-(difluoromethylsulfonyl)benzoate (PubChem CID 7679828) has the molecular formula C18H14F2N2O5S and a molecular weight of 408.38 g/mol. Its IUPAC name is [(2R)-1-(3-cyanoanilino)-1-oxopropan-2-yl] 4-(difluoromethylsulfonyl)benzoate.
| Compound Name | [(2R)-1-(3-cyanoanilino)-1-oxopropan-2-yl] 4-(difluoromethylsulfonyl)benzoate |
|---|---|
| PubChem CID | 7679828 |
| Molecular Formula | C18H14F2N2O5S |
| Molecular Weight | 408.38 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | [(2R)-1-(3-cyanoanilino)-1-oxopropan-2-yl] 4-(difluoromethylsulfonyl)benzoate |
| SMILES | C[C@@H](OC(=O)c1ccc(S(=O)(=O)C(F)F)cc1)C(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C18H14F2N2O5S/c1-11(16(23)22-14-4-2-3-12(9-14)10-21)27-17(24)13-5-7-15(8-6-13)28(25,26)18(19)20/h2-9,11,18H,1H3,(H,22,23)/t11-/m1/s1 |
| InChIKey | JFBJOTILUONFCV-LLVKDONJSA-N |
| XLogP | 2.74 |
| TPSA | 113.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |