C17H12F2N2O5S — CID 2499618
[2-(3-cyanoanilino)-2-oxoethyl] 4-(difluoromethylsulfonyl)benzoate (PubChem CID 2499618) has the molecular formula C17H12F2N2O5S and a molecular weight of 394.36 g/mol. Its IUPAC name is [2-(3-cyanoanilino)-2-oxoethyl] 4-(difluoromethylsulfonyl)benzoate.
| Compound Name | [2-(3-cyanoanilino)-2-oxoethyl] 4-(difluoromethylsulfonyl)benzoate |
|---|---|
| PubChem CID | 2499618 |
| Molecular Formula | C17H12F2N2O5S |
| Molecular Weight | 394.36 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | [2-(3-cyanoanilino)-2-oxoethyl] 4-(difluoromethylsulfonyl)benzoate |
| SMILES | N#Cc1cccc(NC(=O)COC(=O)c2ccc(S(=O)(=O)C(F)F)cc2)c1 |
| InChI | InChI=1S/C17H12F2N2O5S/c18-17(19)27(24,25)14-6-4-12(5-7-14)16(23)26-10-15(22)21-13-3-1-2-11(8-13)9-20/h1-8,17H,10H2,(H,21,22) |
| InChIKey | JVJLMTMUARVJPH-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 113.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.36 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |