C18H16F2N2O6S — CID 55310490
[2-(4-acetamidoanilino)-2-oxoethyl] 4-(difluoromethylsulfonyl)benzoate (PubChem CID 55310490) has the molecular formula C18H16F2N2O6S and a molecular weight of 426.40 g/mol. Its IUPAC name is [2-(4-acetamidoanilino)-2-oxoethyl] 4-(difluoromethylsulfonyl)benzoate.
| Compound Name | [2-(4-acetamidoanilino)-2-oxoethyl] 4-(difluoromethylsulfonyl)benzoate |
|---|---|
| PubChem CID | 55310490 |
| Molecular Formula | C18H16F2N2O6S |
| Molecular Weight | 426.40 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | [2-(4-acetamidoanilino)-2-oxoethyl] 4-(difluoromethylsulfonyl)benzoate |
| SMILES | CC(=O)Nc1ccc(NC(=O)COC(=O)c2ccc(S(=O)(=O)C(F)F)cc2)cc1 |
| InChI | InChI=1S/C18H16F2N2O6S/c1-11(23)21-13-4-6-14(7-5-13)22-16(24)10-28-17(25)12-2-8-15(9-3-12)29(26,27)18(19)20/h2-9,18H,10H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | NZZHTTBFOQOBPX-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.40 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |