C16H10Cl3F2NO5S — CID 16513327
[2-oxo-2-(2,4,6-trichloroanilino)ethyl] 4-(difluoromethylsulfonyl)benzoate (PubChem CID 16513327) has the molecular formula C16H10Cl3F2NO5S and a molecular weight of 472.68 g/mol. Its IUPAC name is [2-oxo-2-(2,4,6-trichloroanilino)ethyl] 4-(difluoromethylsulfonyl)benzoate.
| Compound Name | [2-oxo-2-(2,4,6-trichloroanilino)ethyl] 4-(difluoromethylsulfonyl)benzoate |
|---|---|
| PubChem CID | 16513327 |
| Molecular Formula | C16H10Cl3F2NO5S |
| Molecular Weight | 472.68 g/mol |
| Exact Mass | 470.93 |
| IUPAC Name | [2-oxo-2-(2,4,6-trichloroanilino)ethyl] 4-(difluoromethylsulfonyl)benzoate |
| SMILES | O=C(COC(=O)c1ccc(S(=O)(=O)C(F)F)cc1)Nc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C16H10Cl3F2NO5S/c17-9-5-11(18)14(12(19)6-9)22-13(23)7-27-15(24)8-1-3-10(4-2-8)28(25,26)16(20)21/h1-6,16H,7H2,(H,22,23) |
| InChIKey | CMGGJTXUEMMBRC-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.68 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |