C17H12F5NO5S — CID 2499508
[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] 4-(difluoromethylsulfonyl)benzoate (PubChem CID 2499508) has the molecular formula C17H12F5NO5S and a molecular weight of 437.34 g/mol. Its IUPAC name is [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] 4-(difluoromethylsulfonyl)benzoate.
| Compound Name | [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] 4-(difluoromethylsulfonyl)benzoate |
|---|---|
| PubChem CID | 2499508 |
| Molecular Formula | C17H12F5NO5S |
| Molecular Weight | 437.34 g/mol |
| Exact Mass | 437.04 |
| IUPAC Name | [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] 4-(difluoromethylsulfonyl)benzoate |
| SMILES | O=C(COC(=O)c1ccc(S(=O)(=O)C(F)F)cc1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H12F5NO5S/c18-16(19)29(26,27)13-6-4-10(5-7-13)15(25)28-9-14(24)23-12-3-1-2-11(8-12)17(20,21)22/h1-8,16H,9H2,(H,23,24) |
| InChIKey | FVGHSOBREXFXFD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.34 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |