C20H15F3N2O6 — CID 19059755
(E)-4-oxo-4-[4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]carbonylanilino]but-2-enoic acid (PubChem CID 19059755) has the molecular formula C20H15F3N2O6 and a molecular weight of 436.34 g/mol. Its IUPAC name is (E)-4-oxo-4-[4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]carbonylanilino]but-2-enoic acid.
| Compound Name | (E)-4-oxo-4-[4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]carbonylanilino]but-2-enoic acid |
|---|---|
| PubChem CID | 19059755 |
| Molecular Formula | C20H15F3N2O6 |
| Molecular Weight | 436.34 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | (E)-4-oxo-4-[4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]carbonylanilino]but-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)Nc1ccc(C(=O)OCC(=O)Nc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C20H15F3N2O6/c21-20(22,23)13-2-1-3-15(10-13)25-17(27)11-31-19(30)12-4-6-14(7-5-12)24-16(26)8-9-18(28)29/h1-10H,11H2,(H,24,26)(H,25,27)(H,28,29)/b9-8+ |
| InChIKey | AXPZCTNFNBRVHJ-CMDGGOBGSA-N |
| XLogP | 3.08 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|