C24H16F6N2O5 — CID 2407813
[2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]benzoate (PubChem CID 2407813) has the molecular formula C24H16F6N2O5 and a molecular weight of 526.39 g/mol. Its IUPAC name is [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]benzoate.
| Compound Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]benzoate |
|---|---|
| PubChem CID | 2407813 |
| Molecular Formula | C24H16F6N2O5 |
| Molecular Weight | 526.39 g/mol |
| Exact Mass | 526.10 |
| IUPAC Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]benzoate |
| SMILES | O=C(COc1ccc(C(=O)OCC(=O)Nc2ccc(F)c(F)c2F)cc1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H16F6N2O5/c25-17-8-9-18(22(27)21(17)26)32-20(34)12-37-23(35)13-4-6-16(7-5-13)36-11-19(33)31-15-3-1-2-14(10-15)24(28,29)30/h1-10H,11-12H2,(H,31,33)(H,32,34) |
| InChIKey | YTAUTIYTFXSIFV-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.39 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|