C24H20ClFN2O6 — CID 16539004
[2-(4-chloro-2-fluoroanilino)-2-oxoethyl] 4-[2-(3-methoxyanilino)-2-oxoethoxy]benzoate (PubChem CID 16539004) has the molecular formula C24H20ClFN2O6 and a molecular weight of 486.88 g/mol. Its IUPAC name is [2-(4-chloro-2-fluoroanilino)-2-oxoethyl] 4-[2-(3-methoxyanilino)-2-oxoethoxy]benzoate.
| Compound Name | [2-(4-chloro-2-fluoroanilino)-2-oxoethyl] 4-[2-(3-methoxyanilino)-2-oxoethoxy]benzoate |
|---|---|
| PubChem CID | 16539004 |
| Molecular Formula | C24H20ClFN2O6 |
| Molecular Weight | 486.88 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | [2-(4-chloro-2-fluoroanilino)-2-oxoethyl] 4-[2-(3-methoxyanilino)-2-oxoethoxy]benzoate |
| SMILES | COc1cccc(NC(=O)COc2ccc(C(=O)OCC(=O)Nc3ccc(Cl)cc3F)cc2)c1 |
| InChI | InChI=1S/C24H20ClFN2O6/c1-32-19-4-2-3-17(12-19)27-22(29)13-33-18-8-5-15(6-9-18)24(31)34-14-23(30)28-21-10-7-16(25)11-20(21)26/h2-12H,13-14H2,1H3,(H,27,29)(H,28,30) |
| InChIKey | OWLUIPKDBIOULF-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.88 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |