C27H28N2O6 — CID 16538998
[2-oxo-2-(2-propan-2-ylanilino)ethyl] 4-[2-(3-methoxyanilino)-2-oxoethoxy]benzoate (PubChem CID 16538998) has the molecular formula C27H28N2O6 and a molecular weight of 476.53 g/mol. Its IUPAC name is [2-oxo-2-(2-propan-2-ylanilino)ethyl] 4-[2-(3-methoxyanilino)-2-oxoethoxy]benzoate.
| Compound Name | [2-oxo-2-(2-propan-2-ylanilino)ethyl] 4-[2-(3-methoxyanilino)-2-oxoethoxy]benzoate |
|---|---|
| PubChem CID | 16538998 |
| Molecular Formula | C27H28N2O6 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | [2-oxo-2-(2-propan-2-ylanilino)ethyl] 4-[2-(3-methoxyanilino)-2-oxoethoxy]benzoate |
| SMILES | COc1cccc(NC(=O)COc2ccc(C(=O)OCC(=O)Nc3ccccc3C(C)C)cc2)c1 |
| InChI | InChI=1S/C27H28N2O6/c1-18(2)23-9-4-5-10-24(23)29-26(31)17-35-27(32)19-11-13-21(14-12-19)34-16-25(30)28-20-7-6-8-22(15-20)33-3/h4-15,18H,16-17H2,1-3H3,(H,28,30)(H,29,31) |
| InChIKey | VVVIWPBCAQSWAC-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |