C26H26N2O6 — CID 3453906
[2-oxo-2-(2-phenylethylamino)ethyl] 4-[2-(3-methoxyanilino)-2-oxoethoxy]benzoate (PubChem CID 3453906) has the molecular formula C26H26N2O6 and a molecular weight of 462.50 g/mol. Its IUPAC name is [2-oxo-2-(2-phenylethylamino)ethyl] 4-[2-(3-methoxyanilino)-2-oxoethoxy]benzoate.
| Compound Name | [2-oxo-2-(2-phenylethylamino)ethyl] 4-[2-(3-methoxyanilino)-2-oxoethoxy]benzoate |
|---|---|
| PubChem CID | 3453906 |
| Molecular Formula | C26H26N2O6 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | [2-oxo-2-(2-phenylethylamino)ethyl] 4-[2-(3-methoxyanilino)-2-oxoethoxy]benzoate |
| SMILES | COc1cccc(NC(=O)COc2ccc(C(=O)OCC(=O)NCCc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C26H26N2O6/c1-32-23-9-5-8-21(16-23)28-25(30)18-33-22-12-10-20(11-13-22)26(31)34-17-24(29)27-15-14-19-6-3-2-4-7-19/h2-13,16H,14-15,17-18H2,1H3,(H,27,29)(H,28,30) |
| InChIKey | BTBIPLXMSFHIDH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |