C25H22N2O7 — CID 16538923
(2-benzamido-2-oxoethyl) 4-[2-(3-methoxyanilino)-2-oxoethoxy]benzoate (PubChem CID 16538923) has the molecular formula C25H22N2O7 and a molecular weight of 462.46 g/mol. Its IUPAC name is (2-benzamido-2-oxoethyl) 4-[2-(3-methoxyanilino)-2-oxoethoxy]benzoate.
| Compound Name | (2-benzamido-2-oxoethyl) 4-[2-(3-methoxyanilino)-2-oxoethoxy]benzoate |
|---|---|
| PubChem CID | 16538923 |
| Molecular Formula | C25H22N2O7 |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | (2-benzamido-2-oxoethyl) 4-[2-(3-methoxyanilino)-2-oxoethoxy]benzoate |
| SMILES | COc1cccc(NC(=O)COc2ccc(C(=O)OCC(=O)NC(=O)c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C25H22N2O7/c1-32-21-9-5-8-19(14-21)26-22(28)15-33-20-12-10-18(11-13-20)25(31)34-16-23(29)27-24(30)17-6-3-2-4-7-17/h2-14H,15-16H2,1H3,(H,26,28)(H,27,29,30) |
| InChIKey | LRWZGHHVYKSPNO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |