C26H27N3O6 — CID 16538978
[2-[4-(dimethylamino)anilino]-2-oxoethyl] 4-[2-(3-methoxyanilino)-2-oxoethoxy]benzoate (PubChem CID 16538978) has the molecular formula C26H27N3O6 and a molecular weight of 477.52 g/mol. Its IUPAC name is [2-[4-(dimethylamino)anilino]-2-oxoethyl] 4-[2-(3-methoxyanilino)-2-oxoethoxy]benzoate.
| Compound Name | [2-[4-(dimethylamino)anilino]-2-oxoethyl] 4-[2-(3-methoxyanilino)-2-oxoethoxy]benzoate |
|---|---|
| PubChem CID | 16538978 |
| Molecular Formula | C26H27N3O6 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | [2-[4-(dimethylamino)anilino]-2-oxoethyl] 4-[2-(3-methoxyanilino)-2-oxoethoxy]benzoate |
| SMILES | COc1cccc(NC(=O)COc2ccc(C(=O)OCC(=O)Nc3ccc(N(C)C)cc3)cc2)c1 |
| InChI | InChI=1S/C26H27N3O6/c1-29(2)21-11-9-19(10-12-21)27-25(31)17-35-26(32)18-7-13-22(14-8-18)34-16-24(30)28-20-5-4-6-23(15-20)33-3/h4-15H,16-17H2,1-3H3,(H,27,31)(H,28,30) |
| InChIKey | MHRDQDGVLRULSC-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|