C22H18F3N3O5 — CID 98408633
[(Z)-4-amino-3-cyano-2-oxopent-3-enyl] 4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]benzoate (PubChem CID 98408633) has the molecular formula C22H18F3N3O5 and a molecular weight of 461.40 g/mol. Its IUPAC name is [(Z)-4-amino-3-cyano-2-oxopent-3-enyl] 4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]benzoate.
| Compound Name | [(Z)-4-amino-3-cyano-2-oxopent-3-enyl] 4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]benzoate |
|---|---|
| PubChem CID | 98408633 |
| Molecular Formula | C22H18F3N3O5 |
| Molecular Weight | 461.40 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | [(Z)-4-amino-3-cyano-2-oxopent-3-enyl] 4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]benzoate |
| SMILES | C/C(N)=C(\C#N)C(=O)COC(=O)c1ccc(OCC(=O)Nc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C22H18F3N3O5/c1-13(27)18(10-26)19(29)11-33-21(31)14-5-7-17(8-6-14)32-12-20(30)28-16-4-2-3-15(9-16)22(23,24)25/h2-9H,11-12,27H2,1H3,(H,28,30)/b18-13- |
| InChIKey | AKJXKLYTKRYRBV-AQTBWJFISA-N |
| XLogP | 3.21 |
| TPSA | 131.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|