C24H18F3N3O4 — CID 55800391
N-[3-(cyanomethoxy)phenyl]-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]benzamide (PubChem CID 55800391) has the molecular formula C24H18F3N3O4 and a molecular weight of 469.42 g/mol. Its IUPAC name is N-[3-(cyanomethoxy)phenyl]-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]benzamide.
| Compound Name | N-[3-(cyanomethoxy)phenyl]-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]benzamide |
|---|---|
| PubChem CID | 55800391 |
| Molecular Formula | C24H18F3N3O4 |
| Molecular Weight | 469.42 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | N-[3-(cyanomethoxy)phenyl]-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]benzamide |
| SMILES | N#CCOc1cccc(NC(=O)c2ccc(OCC(=O)Nc3cccc(C(F)(F)F)c3)cc2)c1 |
| InChI | InChI=1S/C24H18F3N3O4/c25-24(26,27)17-3-1-4-18(13-17)29-22(31)15-34-20-9-7-16(8-10-20)23(32)30-19-5-2-6-21(14-19)33-12-11-28/h1-10,13-14H,12,15H2,(H,29,31)(H,30,32) |
| InChIKey | FAMWAXKHPCUQIK-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.42 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |