C23H18ClF3N2O4 — CID 1191704
N-(3-chloro-4-methoxyphenyl)-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]benzamide (PubChem CID 1191704) has the molecular formula C23H18ClF3N2O4 and a molecular weight of 478.85 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]benzamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]benzamide |
|---|---|
| PubChem CID | 1191704 |
| Molecular Formula | C23H18ClF3N2O4 |
| Molecular Weight | 478.85 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]benzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(OCC(=O)Nc3cccc(C(F)(F)F)c3)cc2)cc1Cl |
| InChI | InChI=1S/C23H18ClF3N2O4/c1-32-20-10-7-17(12-19(20)24)29-22(31)14-5-8-18(9-6-14)33-13-21(30)28-16-4-2-3-15(11-16)23(25,26)27/h2-12H,13H2,1H3,(H,28,30)(H,29,31) |
| InChIKey | KTTOIUCYDWOUGV-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.85 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |