C24H21F3N2O5 — CID 55345310
N-(2,5-dimethoxyphenyl)-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]benzamide (PubChem CID 55345310) has the molecular formula C24H21F3N2O5 and a molecular weight of 474.44 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]benzamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]benzamide |
|---|---|
| PubChem CID | 55345310 |
| Molecular Formula | C24H21F3N2O5 |
| Molecular Weight | 474.44 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]benzamide |
| SMILES | COc1ccc(OC)c(NC(=O)c2ccc(OCC(=O)Nc3cccc(C(F)(F)F)c3)cc2)c1 |
| InChI | InChI=1S/C24H21F3N2O5/c1-32-19-10-11-21(33-2)20(13-19)29-23(31)15-6-8-18(9-7-15)34-14-22(30)28-17-5-3-4-16(12-17)24(25,26)27/h3-13H,14H2,1-2H3,(H,28,30)(H,29,31) |
| InChIKey | FSUULOQAORZALJ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.44 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |