C24H24N2O6 — CID 46323188
4-methoxy-N-[2-methoxy-5-[[2-(4-methoxyphenoxy)acetyl]amino]phenyl]benzamide (PubChem CID 46323188) has the molecular formula C24H24N2O6 and a molecular weight of 436.46 g/mol. Its IUPAC name is 4-methoxy-N-[2-methoxy-5-[[2-(4-methoxyphenoxy)acetyl]amino]phenyl]benzamide.
| Compound Name | 4-methoxy-N-[2-methoxy-5-[[2-(4-methoxyphenoxy)acetyl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 46323188 |
| Molecular Formula | C24H24N2O6 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 4-methoxy-N-[2-methoxy-5-[[2-(4-methoxyphenoxy)acetyl]amino]phenyl]benzamide |
| SMILES | COc1ccc(OCC(=O)Nc2ccc(OC)c(NC(=O)c3ccc(OC)cc3)c2)cc1 |
| InChI | InChI=1S/C24H24N2O6/c1-29-18-7-4-16(5-8-18)24(28)26-21-14-17(6-13-22(21)31-3)25-23(27)15-32-20-11-9-19(30-2)10-12-20/h4-14H,15H2,1-3H3,(H,25,27)(H,26,28) |
| InChIKey | QAUHBWXSLSINKU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |