C22H16BrF3N2O3 — CID 28639192
4-[[2-(4-bromophenoxy)acetyl]amino]-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 28639192) has the molecular formula C22H16BrF3N2O3 and a molecular weight of 493.28 g/mol. Its IUPAC name is 4-[[2-(4-bromophenoxy)acetyl]amino]-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 4-[[2-(4-bromophenoxy)acetyl]amino]-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 28639192 |
| Molecular Formula | C22H16BrF3N2O3 |
| Molecular Weight | 493.28 g/mol |
| Exact Mass | 492.03 |
| IUPAC Name | 4-[[2-(4-bromophenoxy)acetyl]amino]-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(COc1ccc(Br)cc1)Nc1ccc(C(=O)Nc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C22H16BrF3N2O3/c23-16-6-10-19(11-7-16)31-13-20(29)27-17-8-4-14(5-9-17)21(30)28-18-3-1-2-15(12-18)22(24,25)26/h1-12H,13H2,(H,27,29)(H,28,30) |
| InChIKey | DYBMQRWLKHPBPE-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.28 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |