C18H15F3N2O4 — CID 9009486
[2-[4-(methylcarbamoyl)anilino]-2-oxoethyl] 4-(trifluoromethyl)benzoate (PubChem CID 9009486) has the molecular formula C18H15F3N2O4 and a molecular weight of 380.32 g/mol. Its IUPAC name is [2-[4-(methylcarbamoyl)anilino]-2-oxoethyl] 4-(trifluoromethyl)benzoate.
| Compound Name | [2-[4-(methylcarbamoyl)anilino]-2-oxoethyl] 4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 9009486 |
| Molecular Formula | C18H15F3N2O4 |
| Molecular Weight | 380.32 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | [2-[4-(methylcarbamoyl)anilino]-2-oxoethyl] 4-(trifluoromethyl)benzoate |
| SMILES | CNC(=O)c1ccc(NC(=O)COC(=O)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C18H15F3N2O4/c1-22-16(25)11-4-8-14(9-5-11)23-15(24)10-27-17(26)12-2-6-13(7-3-12)18(19,20)21/h2-9H,10H2,1H3,(H,22,25)(H,23,24) |
| InChIKey | OTNJXAANVDUAIN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |